C23H29ClN4O2S — CID 67750369
N-[2-[2-[3-[2-(4-chlorophenyl)propan-2-ylamino]propyl]-1H-imidazol-5-yl]ethyl]benzenesulfonamide (PubChem CID 67750369) has the molecular formula C23H29ClN4O2S and a molecular weight of 461.03 g/mol. Its IUPAC name is N-[2-[2-[3-[2-(4-chlorophenyl)propan-2-ylamino]propyl]-1H-imidazol-5-yl]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[2-[3-[2-(4-chlorophenyl)propan-2-ylamino]propyl]-1H-imidazol-5-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67750369 |
| Molecular Formula | C23H29ClN4O2S |
| Molecular Weight | 461.03 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-[2-[2-[3-[2-(4-chlorophenyl)propan-2-ylamino]propyl]-1H-imidazol-5-yl]ethyl]benzenesulfonamide |
| SMILES | CC(C)(NCCCc1ncc(CCNS(=O)(=O)c2ccccc2)[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H29ClN4O2S/c1-23(2,18-10-12-19(24)13-11-18)26-15-6-9-22-25-17-20(28-22)14-16-27-31(29,30)21-7-4-3-5-8-21/h3-5,7-8,10-13,17,26-27H,6,9,14-16H2,1-2H3,(H,25,28) |
| InChIKey | JWBGYJODEAHLRR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.03 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|