C10H16N2O — CID 67753530
2-hept-6-enyl-1,4-dihydroimidazol-5-one (PubChem CID 67753530) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-hept-6-enyl-1,4-dihydroimidazol-5-one.
| Compound Name | 2-hept-6-enyl-1,4-dihydroimidazol-5-one |
|---|---|
| PubChem CID | 67753530 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-hept-6-enyl-1,4-dihydroimidazol-5-one |
| SMILES | C=CCCCCCC1=NCC(=O)N1 |
| InChI | InChI=1S/C10H16N2O/c1-2-3-4-5-6-7-9-11-8-10(13)12-9/h2H,1,3-8H2,(H,11,12,13) |
| InChIKey | AQMZWHWYJWAELH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|