C40H48N4O7 — CID 67755151
2-[2-[[1-[1-(2,6-dimethoxy-4-methylphenyl)pentylamino]-1-oxo-6-(3-phenylprop-2-enoylamino)hexan-2-yl]carbamoyl]indol-1-yl]acetic acid (PubChem CID 67755151) has the molecular formula C40H48N4O7 and a molecular weight of 696.85 g/mol. Its IUPAC name is 2-[2-[[1-[1-(2,6-dimethoxy-4-methylphenyl)pentylamino]-1-oxo-6-(3-phenylprop-2-enoylamino)hexan-2-yl]carbamoyl]indol-1-yl]acetic acid.
| Compound Name | 2-[2-[[1-[1-(2,6-dimethoxy-4-methylphenyl)pentylamino]-1-oxo-6-(3-phenylprop-2-enoylamino)hexan-2-yl]carbamoyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 67755151 |
| Molecular Formula | C40H48N4O7 |
| Molecular Weight | 696.85 g/mol |
| Exact Mass | 696.35 |
| IUPAC Name | 2-[2-[[1-[1-(2,6-dimethoxy-4-methylphenyl)pentylamino]-1-oxo-6-(3-phenylprop-2-enoylamino)hexan-2-yl]carbamoyl]indol-1-yl]acetic acid |
| SMILES | CCCCC(NC(=O)C(CCCCNC(=O)C=Cc1ccccc1)NC(=O)c1cc2ccccc2n1CC(=O)O)c1c(OC)cc(C)cc1OC |
| InChI | InChI=1S/C40H48N4O7/c1-5-6-17-30(38-34(50-3)23-27(2)24-35(38)51-4)42-39(48)31(18-12-13-22-41-36(45)21-20-28-14-8-7-9-15-28)43-40(49)33-25-29-16-10-11-19-32(29)44(33)26-37(46)47/h7-11,14-16,19-21,23-25,30-31H,5-6,12-13,17-18,22,26H2,1-4H3,(H,41,45)(H,42,48)(H,43,49)(H,46,47) |
| InChIKey | LSSUSSLGNNALPK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.85 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|