About 2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid
2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid (PubChem CID 67754760) has the molecular formula C27H33N3O6
and a molecular weight of 495.58 g/mol. Its IUPAC name is 2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid |
| PubChem CID | 67754760 |
| Molecular Formula | C27H33N3O6 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid |
| SMILES | CCCCCN(C(=O)N(C)C(=O)c1cc2ccccc2n1CC(=O)O)c1c(OC)cc(C)cc1OC |
| InChI | InChI=1S/C27H33N3O6/c1-6-7-10-13-29(25-22(35-4)14-18(2)15-23(25)36-5)27(34)28(3)26(33)21-16-19-11-8-9-12-20(19)30(21)17-24(31)32/h8-9,11-12,14-16H,6-7,10,13,17H2,1-5H3,(H,31,32) |
| InChIKey | PMCYCABWTSUEHL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid?
The IUPAC name of 2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid (CID 67754760) is 2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid.
What is the SMILES notation for 2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid?
The canonical SMILES for 2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid is CCCCCN(C(=O)N(C)C(=O)c1cc2ccccc2n1CC(=O)O)c1c(OC)cc(C)cc1OC.
What is the InChIKey of 2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid?
The InChIKey is PMCYCABWTSUEHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33N3O6/c1-6-7-10-13-29(25-22(35-4)14-18(2)15-23(25)36-5)27(34)28(3)26(33)21-16-19-11-8-9-12-20(19)30(21)17-24(31)32/h8-9,11-12,14-16H,6-7,10,13,17H2,1-5H3,(H,31,32).
What are the key properties of 2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid?
2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid has a molecular weight of 495.58 g/mol, XLogP of 4.94, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]indol-1-yl]acetic acid is sourced from PubChem (CID 67754760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).