C26H32N4O5 — CID 67668385
N-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]-1H-indole-2-carboxamide (PubChem CID 67668385) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is N-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]-1H-indole-2-carboxamide.
| Compound Name | N-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 67668385 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | N-[[(2,6-dimethoxy-4-methylphenyl)-pentylcarbamoyl]-methylcarbamoyl]-1H-indole-2-carboxamide |
| SMILES | CCCCCN(C(=O)N(C)C(=O)NC(=O)c1cc2ccccc2[nH]1)c1c(OC)cc(C)cc1OC |
| InChI | InChI=1S/C26H32N4O5/c1-6-7-10-13-30(23-21(34-4)14-17(2)15-22(23)35-5)26(33)29(3)25(32)28-24(31)20-16-18-11-8-9-12-19(18)27-20/h8-9,11-12,14-16,27H,6-7,10,13H2,1-5H3,(H,28,31,32) |
| InChIKey | WGTXWOHUMZRMNJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|