C36H45NO8 — CID 67756742
[3-methyl-2-[2-[4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-2-phenylmethoxyethyl]phenoxy]ethoxy]phenyl]methyl 2,2-dimethylbutanoate (PubChem CID 67756742) has the molecular formula C36H45NO8 and a molecular weight of 619.76 g/mol. Its IUPAC name is [3-methyl-2-[2-[4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-2-phenylmethoxyethyl]phenoxy]ethoxy]phenyl]methyl 2,2-dimethylbutanoate.
| Compound Name | [3-methyl-2-[2-[4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-2-phenylmethoxyethyl]phenoxy]ethoxy]phenyl]methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 67756742 |
| Molecular Formula | C36H45NO8 |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.31 |
| IUPAC Name | [3-methyl-2-[2-[4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-2-phenylmethoxyethyl]phenoxy]ethoxy]phenyl]methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCc1cccc(C)c1OCCOc1ccc([C@H](NC(=O)OC(C)(C)C)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H45NO8/c1-8-36(6,7)33(39)44-24-28-16-12-13-25(2)31(28)42-22-21-41-29-19-17-27(18-20-29)30(37-34(40)45-35(3,4)5)32(38)43-23-26-14-10-9-11-15-26/h9-20,30H,8,21-24H2,1-7H3,(H,37,40)/t30-/m0/s1 |
| InChIKey | TXBTUPFUZVGYSN-PMERELPUSA-N |
| XLogP | 7.24 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|