C19H24N2 — CID 67763989
N'-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methyl]-N-methylmethanimidamide (PubChem CID 67763989) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is N'-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methyl]-N-methylmethanimidamide.
| Compound Name | N'-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 67763989 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N'-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methyl]-N-methylmethanimidamide |
| SMILES | Cc1ccc(CN(C)/C=N/c2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C19H24N2/c1-14-6-8-18(16(3)10-14)12-21(5)13-20-19-9-7-15(2)11-17(19)4/h6-11,13H,12H2,1-5H3/b20-13+ |
| InChIKey | HRBFKJVBNMBPDQ-DEDYPNTBSA-N |
| XLogP | 4.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|