C21H20O3S — CID 67764114
5-[3-(2-phenylmethoxyphenyl)propyl]thiophene-2-carboxylic acid (PubChem CID 67764114) has the molecular formula C21H20O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is 5-[3-(2-phenylmethoxyphenyl)propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-(2-phenylmethoxyphenyl)propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67764114 |
| Molecular Formula | C21H20O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 5-[3-(2-phenylmethoxyphenyl)propyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCCc2ccccc2OCc2ccccc2)s1 |
| InChI | InChI=1S/C21H20O3S/c22-21(23)20-14-13-18(25-20)11-6-10-17-9-4-5-12-19(17)24-15-16-7-2-1-3-8-16/h1-5,7-9,12-14H,6,10-11,15H2,(H,22,23) |
| InChIKey | ZLNQCBJAGMZFBN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |