C20H25ClO3S — CID 25017342
7-(2-phenylmethoxyphenyl)heptane-1-sulfonyl chloride (PubChem CID 25017342) has the molecular formula C20H25ClO3S and a molecular weight of 380.94 g/mol. Its IUPAC name is 7-(2-phenylmethoxyphenyl)heptane-1-sulfonyl chloride.
| Compound Name | 7-(2-phenylmethoxyphenyl)heptane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 25017342 |
| Molecular Formula | C20H25ClO3S |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 7-(2-phenylmethoxyphenyl)heptane-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)CCCCCCCc1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C20H25ClO3S/c21-25(22,23)16-10-3-1-2-7-13-19-14-8-9-15-20(19)24-17-18-11-5-4-6-12-18/h4-6,8-9,11-12,14-15H,1-3,7,10,13,16-17H2 |
| InChIKey | VFNANICQTWXKCU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|