C18H21FO3S — CID 25017347
5-(2-phenylmethoxyphenyl)pentane-1-sulfonyl fluoride (PubChem CID 25017347) has the molecular formula C18H21FO3S and a molecular weight of 336.43 g/mol. Its IUPAC name is 5-(2-phenylmethoxyphenyl)pentane-1-sulfonyl fluoride.
| Compound Name | 5-(2-phenylmethoxyphenyl)pentane-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 25017347 |
| Molecular Formula | C18H21FO3S |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 5-(2-phenylmethoxyphenyl)pentane-1-sulfonyl fluoride |
| SMILES | O=S(=O)(F)CCCCCc1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C18H21FO3S/c19-23(20,21)14-8-2-5-11-17-12-6-7-13-18(17)22-15-16-9-3-1-4-10-16/h1,3-4,6-7,9-10,12-13H,2,5,8,11,14-15H2 |
| InChIKey | LSUVOQMRMHLNII-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|