C20H26N2O4 — CID 67764312
3,4-dimethyl-1-N,2-N-bis(4-methyl-3-oxopent-4-enyl)cyclobuta-1,3-diene-1,2-dicarboxamide (PubChem CID 67764312) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3,4-dimethyl-1-N,2-N-bis(4-methyl-3-oxopent-4-enyl)cyclobuta-1,3-diene-1,2-dicarboxamide.
| Compound Name | 3,4-dimethyl-1-N,2-N-bis(4-methyl-3-oxopent-4-enyl)cyclobuta-1,3-diene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 67764312 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 3,4-dimethyl-1-N,2-N-bis(4-methyl-3-oxopent-4-enyl)cyclobuta-1,3-diene-1,2-dicarboxamide |
| SMILES | C=C(C)C(=O)CCNC(=O)C1=C(C(=O)NCCC(=O)C(=C)C)C(C)=C1C |
| InChI | InChI=1S/C20H26N2O4/c1-11(2)15(23)7-9-21-19(25)17-13(5)14(6)18(17)20(26)22-10-8-16(24)12(3)4/h1,3,7-10H2,2,4-6H3,(H,21,25)(H,22,26) |
| InChIKey | SSXZUKUQASMRSM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|