C30H35Cl3N6O2 — CID 67764555
2-(4-chlorophenyl)-3-cyclopropyl-1-(1,2,4-triazol-1-yl)butan-2-ol;(E)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-ol (PubChem CID 67764555) has the molecular formula C30H35Cl3N6O2 and a molecular weight of 618.01 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-cyclopropyl-1-(1,2,4-triazol-1-yl)butan-2-ol;(E)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-ol.
| Compound Name | 2-(4-chlorophenyl)-3-cyclopropyl-1-(1,2,4-triazol-1-yl)butan-2-ol;(E)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-ol |
|---|---|
| PubChem CID | 67764555 |
| Molecular Formula | C30H35Cl3N6O2 |
| Molecular Weight | 618.01 g/mol |
| Exact Mass | 616.19 |
| IUPAC Name | 2-(4-chlorophenyl)-3-cyclopropyl-1-(1,2,4-triazol-1-yl)butan-2-ol;(E)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-ol |
| SMILES | CC(C)(C)C(O)/C(=C\c1ccc(Cl)cc1Cl)n1cncn1.CC(C1CC1)C(O)(Cn1cncn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17Cl2N3O.C15H18ClN3O/c1-15(2,3)14(21)13(20-9-18-8-19-20)6-10-4-5-11(16)7-12(10)17;1-11(12-2-3-12)15(20,8-19-10-17-9-18-19)13-4-6-14(16)7-5-13/h4-9,14,21H,1-3H3;4-7,9-12,20H,2-3,8H2,1H3/b13-6+; |
| InChIKey | AXXZXYLTQVLCSW-AWFSDRIXSA-N |
| XLogP | 6.86 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.01 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |