C28H26FNO4 — CID 67766146
methyl 4-[2-[[4-(1-benzofuran-2-yl)-2-fluorophenyl]carbamoyl]pentyl]benzoate (PubChem CID 67766146) has the molecular formula C28H26FNO4 and a molecular weight of 459.52 g/mol. Its IUPAC name is methyl 4-[2-[[4-(1-benzofuran-2-yl)-2-fluorophenyl]carbamoyl]pentyl]benzoate.
| Compound Name | methyl 4-[2-[[4-(1-benzofuran-2-yl)-2-fluorophenyl]carbamoyl]pentyl]benzoate |
|---|---|
| PubChem CID | 67766146 |
| Molecular Formula | C28H26FNO4 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | methyl 4-[2-[[4-(1-benzofuran-2-yl)-2-fluorophenyl]carbamoyl]pentyl]benzoate |
| SMILES | CCCC(Cc1ccc(C(=O)OC)cc1)C(=O)Nc1ccc(-c2cc3ccccc3o2)cc1F |
| InChI | InChI=1S/C28H26FNO4/c1-3-6-22(15-18-9-11-19(12-10-18)28(32)33-2)27(31)30-24-14-13-21(16-23(24)29)26-17-20-7-4-5-8-25(20)34-26/h4-5,7-14,16-17,22H,3,6,15H2,1-2H3,(H,30,31) |
| InChIKey | YSIICFNMNDDCAJ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |