C32H26O6 — CID 67767877
dimethyl 4-[(E)-2-benzyl-3-oxo-3-(4-phenoxyphenyl)prop-1-enyl]benzene-1,2-dicarboxylate (PubChem CID 67767877) has the molecular formula C32H26O6 and a molecular weight of 506.55 g/mol. Its IUPAC name is dimethyl 4-[(E)-2-benzyl-3-oxo-3-(4-phenoxyphenyl)prop-1-enyl]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-[(E)-2-benzyl-3-oxo-3-(4-phenoxyphenyl)prop-1-enyl]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67767877 |
| Molecular Formula | C32H26O6 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | dimethyl 4-[(E)-2-benzyl-3-oxo-3-(4-phenoxyphenyl)prop-1-enyl]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(/C=C(\Cc2ccccc2)C(=O)c2ccc(Oc3ccccc3)cc2)cc1C(=O)OC |
| InChI | InChI=1S/C32H26O6/c1-36-31(34)28-18-13-23(21-29(28)32(35)37-2)20-25(19-22-9-5-3-6-10-22)30(33)24-14-16-27(17-15-24)38-26-11-7-4-8-12-26/h3-18,20-21H,19H2,1-2H3/b25-20+ |
| InChIKey | BQTNNCOYYSMFOR-LKUDQCMESA-N |
| XLogP | 6.56 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|