C30H24O5 — CID 67767796
4-[(E)-2-benzyl-3-(4-phenoxyphenyl)prop-1-enyl]phthalic acid (PubChem CID 67767796) has the molecular formula C30H24O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is 4-[(E)-2-benzyl-3-(4-phenoxyphenyl)prop-1-enyl]phthalic acid.
| Compound Name | 4-[(E)-2-benzyl-3-(4-phenoxyphenyl)prop-1-enyl]phthalic acid |
|---|---|
| PubChem CID | 67767796 |
| Molecular Formula | C30H24O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 4-[(E)-2-benzyl-3-(4-phenoxyphenyl)prop-1-enyl]phthalic acid |
| SMILES | O=C(O)c1ccc(/C=C(\Cc2ccccc2)Cc2ccc(Oc3ccccc3)cc2)cc1C(=O)O |
| InChI | InChI=1S/C30H24O5/c31-29(32)27-16-13-23(20-28(27)30(33)34)19-24(17-21-7-3-1-4-8-21)18-22-11-14-26(15-12-22)35-25-9-5-2-6-10-25/h1-16,19-20H,17-18H2,(H,31,32)(H,33,34)/b24-19+ |
| InChIKey | MXTMNMWNPBMDRQ-LYBHJNIJSA-N |
| XLogP | 6.74 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |