C23H24N4O6S — CID 67768896
2-[3-methyl-2-[[3-(2,4,6-trimethoxyphenyl)-2H-1,2,4-thiadiazol-3-yl]carbamoyl]indol-1-yl]acetic acid (PubChem CID 67768896) has the molecular formula C23H24N4O6S and a molecular weight of 484.53 g/mol. Its IUPAC name is 2-[3-methyl-2-[[3-(2,4,6-trimethoxyphenyl)-2H-1,2,4-thiadiazol-3-yl]carbamoyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-methyl-2-[[3-(2,4,6-trimethoxyphenyl)-2H-1,2,4-thiadiazol-3-yl]carbamoyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 67768896 |
| Molecular Formula | C23H24N4O6S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-[3-methyl-2-[[3-(2,4,6-trimethoxyphenyl)-2H-1,2,4-thiadiazol-3-yl]carbamoyl]indol-1-yl]acetic acid |
| SMILES | COc1cc(OC)c(C2(NC(=O)c3c(C)c4ccccc4n3CC(=O)O)N=CSN2)c(OC)c1 |
| InChI | InChI=1S/C23H24N4O6S/c1-13-15-7-5-6-8-16(15)27(11-19(28)29)21(13)22(30)25-23(24-12-34-26-23)20-17(32-3)9-14(31-2)10-18(20)33-4/h5-10,12,26H,11H2,1-4H3,(H,25,30)(H,28,29) |
| InChIKey | TZOJFTKQTPOXPX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|