About [(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid
[(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid (PubChem CID 67775635) has the molecular formula C20H21FN4O2
and a molecular weight of 368.41 g/mol. Its IUPAC name is [(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid.
Molecular Properties
| Compound Name | [(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid |
| PubChem CID | 67775635 |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid |
| SMILES | N#Cc1ccc(N[C@@H]2CCCC[C@@H]2NC(=O)O)cc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN4O2/c21-14-6-9-15(10-7-14)23-19-11-16(8-5-13(19)12-22)24-17-3-1-2-4-18(17)25-20(26)27/h5-11,17-18,23-25H,1-4H2,(H,26,27)/t17-,18+/m1/s1 |
| InChIKey | PVEBBDZSWLWBDE-MSOLQXFVSA-N |
| XLogP | 4.43 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid?
The IUPAC name of [(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid (CID 67775635) is [(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid.
What is the SMILES notation for [(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid?
The canonical SMILES for [(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid is N#Cc1ccc(N[C@@H]2CCCC[C@@H]2NC(=O)O)cc1Nc1ccc(F)cc1.
What is the InChIKey of [(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid?
The InChIKey is PVEBBDZSWLWBDE-MSOLQXFVSA-N. The full InChI is InChI=1S/C20H21FN4O2/c21-14-6-9-15(10-7-14)23-19-11-16(8-5-13(19)12-22)24-17-3-1-2-4-18(17)25-20(26)27/h5-11,17-18,23-25H,1-4H2,(H,26,27)/t17-,18+/m1/s1.
What are the key properties of [(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid?
[(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid has a molecular weight of 368.41 g/mol, XLogP of 4.43, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-[4-cyano-3-(4-fluoroanilino)anilino]cyclohexyl]carbamic acid is sourced from PubChem (CID 67775635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).