About 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile
2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile (PubChem CID 129386263) has the molecular formula C17H19N5OS
and a molecular weight of 341.44 g/mol. Its IUPAC name is 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile |
| PubChem CID | 129386263 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile |
| SMILES | Cc1cc(Nc2cc(N[C@@H]3CCCCNC3=O)ccc2C#N)sn1 |
| InChI | InChI=1S/C17H19N5OS/c1-11-8-16(24-22-11)21-15-9-13(6-5-12(15)10-18)20-14-4-2-3-7-19-17(14)23/h5-6,8-9,14,20-21H,2-4,7H2,1H3,(H,19,23)/t14-/m1/s1 |
| InChIKey | OOCHXIGEHWFZOG-CQSZACIVSA-N |
| XLogP | 3.15 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile?
The IUPAC name of 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile (CID 129386263) is 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile.
What is the SMILES notation for 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile?
The canonical SMILES for 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile is Cc1cc(Nc2cc(N[C@@H]3CCCCNC3=O)ccc2C#N)sn1.
What is the InChIKey of 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile?
The InChIKey is OOCHXIGEHWFZOG-CQSZACIVSA-N. The full InChI is InChI=1S/C17H19N5OS/c1-11-8-16(24-22-11)21-15-9-13(6-5-12(15)10-18)20-14-4-2-3-7-19-17(14)23/h5-6,8-9,14,20-21H,2-4,7H2,1H3,(H,19,23)/t14-/m1/s1.
What are the key properties of 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile?
2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile has a molecular weight of 341.44 g/mol, XLogP of 3.15, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-2-oxoazepan-3-yl]amino]benzonitrile is sourced from PubChem (CID 129386263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).