C18H25N5OS — CID 163461308
2-[[(Z)-3-amino-3-methyl-1-sulfanylbut-1-enyl]amino]-4-[(2-oxoazepan-3-yl)amino]benzonitrile (PubChem CID 163461308) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is 2-[[(Z)-3-amino-3-methyl-1-sulfanylbut-1-enyl]amino]-4-[(2-oxoazepan-3-yl)amino]benzonitrile.
| Compound Name | 2-[[(Z)-3-amino-3-methyl-1-sulfanylbut-1-enyl]amino]-4-[(2-oxoazepan-3-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 163461308 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-[[(Z)-3-amino-3-methyl-1-sulfanylbut-1-enyl]amino]-4-[(2-oxoazepan-3-yl)amino]benzonitrile |
| SMILES | CC(C)(N)/C=C(\S)Nc1cc(NC2CCCCNC2=O)ccc1C#N |
| InChI | InChI=1S/C18H25N5OS/c1-18(2,20)10-16(25)23-15-9-13(7-6-12(15)11-19)22-14-5-3-4-8-21-17(14)24/h6-7,9-10,14,22-23,25H,3-5,8,20H2,1-2H3,(H,21,24)/b16-10- |
| InChIKey | BOUOMPXAOXLVTJ-YBEGLDIGSA-N |
| XLogP | 2.56 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|