C28H33FNO3P — CID 67777247
3-[[4-[4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]phenyl]methylamino]propylphosphonic acid (PubChem CID 67777247) has the molecular formula C28H33FNO3P and a molecular weight of 481.55 g/mol. Its IUPAC name is 3-[[4-[4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 67777247 |
| Molecular Formula | C28H33FNO3P |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 3-[[4-[4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]phenyl]methylamino]propylphosphonic acid |
| SMILES | Cc1ccc(CC(C=Cc2ccc(CNCCCP(=O)(O)O)cc2)c2cccc(F)c2)cc1C |
| InChI | InChI=1S/C28H33FNO3P/c1-21-7-8-25(17-22(21)2)18-27(26-5-3-6-28(29)19-26)14-13-23-9-11-24(12-10-23)20-30-15-4-16-34(31,32)33/h3,5-14,17,19,27,30H,4,15-16,18,20H2,1-2H3,(H2,31,32,33) |
| InChIKey | XFJSBBVGDXWAIW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|