C29H36F2NO3PS — CID 71711503
3-[[4-[4-(3,5-difluorophenyl)-5-(3,4-dimethylphenyl)pentyl]sulfanylphenyl]methylamino]propylphosphonic acid (PubChem CID 71711503) has the molecular formula C29H36F2NO3PS and a molecular weight of 547.65 g/mol. Its IUPAC name is 3-[[4-[4-(3,5-difluorophenyl)-5-(3,4-dimethylphenyl)pentyl]sulfanylphenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[4-(3,5-difluorophenyl)-5-(3,4-dimethylphenyl)pentyl]sulfanylphenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 71711503 |
| Molecular Formula | C29H36F2NO3PS |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 3-[[4-[4-(3,5-difluorophenyl)-5-(3,4-dimethylphenyl)pentyl]sulfanylphenyl]methylamino]propylphosphonic acid |
| SMILES | Cc1ccc(CC(CCCSc2ccc(CNCCCP(=O)(O)O)cc2)c2cc(F)cc(F)c2)cc1C |
| InChI | InChI=1S/C29H36F2NO3PS/c1-21-6-7-24(15-22(21)2)16-25(26-17-27(30)19-28(31)18-26)5-3-14-37-29-10-8-23(9-11-29)20-32-12-4-13-36(33,34)35/h6-11,15,17-19,25,32H,3-5,12-14,16,20H2,1-2H3,(H2,33,34,35) |
| InChIKey | RTLDMXLBQDYSBI-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|