C19H16N4O3 — CID 67778312
N-[(5-amino-1-benzofuran-2-yl)methyl]-3-methyl-4-oxidoquinoxalin-4-ium-2-carboxamide (PubChem CID 67778312) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is N-[(5-amino-1-benzofuran-2-yl)methyl]-3-methyl-4-oxidoquinoxalin-4-ium-2-carboxamide.
| Compound Name | N-[(5-amino-1-benzofuran-2-yl)methyl]-3-methyl-4-oxidoquinoxalin-4-ium-2-carboxamide |
|---|---|
| PubChem CID | 67778312 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-[(5-amino-1-benzofuran-2-yl)methyl]-3-methyl-4-oxidoquinoxalin-4-ium-2-carboxamide |
| SMILES | Cc1c(C(=O)NCc2cc3cc(N)ccc3o2)nc2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C19H16N4O3/c1-11-18(22-15-4-2-3-5-16(15)23(11)25)19(24)21-10-14-9-12-8-13(20)6-7-17(12)26-14/h2-9H,10,20H2,1H3,(H,21,24) |
| InChIKey | HEQOAISOASJHCN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|