C17H18O4 — CID 67778956
1-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)-3-(2-methoxyphenyl)prop-2-en-1-one (PubChem CID 67778956) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)-3-(2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)-3-(2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67778956 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)-3-(2-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccccc1C=CC(=O)C1=CCC(O)(OC)C=C1 |
| InChI | InChI=1S/C17H18O4/c1-20-16-6-4-3-5-14(16)7-8-15(18)13-9-11-17(19,21-2)12-10-13/h3-11,19H,12H2,1-2H3 |
| InChIKey | NVXVUTMWWKZTEW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|