C29H29N3O2 — CID 67780070
1,2-dimethyl-1,3-bis(3-phenylmethoxyphenyl)guanidine (PubChem CID 67780070) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 1,2-dimethyl-1,3-bis(3-phenylmethoxyphenyl)guanidine.
| Compound Name | 1,2-dimethyl-1,3-bis(3-phenylmethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 67780070 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 1,2-dimethyl-1,3-bis(3-phenylmethoxyphenyl)guanidine |
| SMILES | C/N=C(\Nc1cccc(OCc2ccccc2)c1)N(C)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H29N3O2/c1-30-29(31-25-15-9-17-27(19-25)33-21-23-11-5-3-6-12-23)32(2)26-16-10-18-28(20-26)34-22-24-13-7-4-8-14-24/h3-20H,21-22H2,1-2H3,(H,30,31) |
| InChIKey | ODOTWNIUOKRQJA-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|