C16H30N2O4 — CID 67780429
tert-butyl 1-[1-[(2-ethoxy-2-oxoethyl)amino]ethyl]piperidine-2-carboxylate (PubChem CID 67780429) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is tert-butyl 1-[1-[(2-ethoxy-2-oxoethyl)amino]ethyl]piperidine-2-carboxylate.
| Compound Name | tert-butyl 1-[1-[(2-ethoxy-2-oxoethyl)amino]ethyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 67780429 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | tert-butyl 1-[1-[(2-ethoxy-2-oxoethyl)amino]ethyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)CNC(C)N1CCCCC1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N2O4/c1-6-21-14(19)11-17-12(2)18-10-8-7-9-13(18)15(20)22-16(3,4)5/h12-13,17H,6-11H2,1-5H3 |
| InChIKey | YZONLDIYOBTOIY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |