C21H21ClFN3O — CID 67781501
N'-[3-[(4-fluorophenyl)methoxy]-2-pyridinyl]-2-(2-methylphenyl)ethanimidamide;hydrochloride (PubChem CID 67781501) has the molecular formula C21H21ClFN3O and a molecular weight of 385.87 g/mol. Its IUPAC name is N'-[3-[(4-fluorophenyl)methoxy]-2-pyridinyl]-2-(2-methylphenyl)ethanimidamide;hydrochloride.
| Compound Name | N'-[3-[(4-fluorophenyl)methoxy]-2-pyridinyl]-2-(2-methylphenyl)ethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 67781501 |
| Molecular Formula | C21H21ClFN3O |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N'-[3-[(4-fluorophenyl)methoxy]-2-pyridinyl]-2-(2-methylphenyl)ethanimidamide;hydrochloride |
| SMILES | Cc1ccccc1CC(N)=Nc1ncccc1OCc1ccc(F)cc1.Cl |
| InChI | InChI=1S/C21H20FN3O.ClH/c1-15-5-2-3-6-17(15)13-20(23)25-21-19(7-4-12-24-21)26-14-16-8-10-18(22)11-9-16;/h2-12H,13-14H2,1H3,(H2,23,24,25);1H |
| InChIKey | DOCVKTRGLREEIX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|