About ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione
ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione (PubChem CID 67782254) has the molecular formula C8H12N2O3
and a molecular weight of 184.20 g/mol. Its IUPAC name is ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione.
Molecular Properties
| Compound Name | ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione |
| PubChem CID | 67782254 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione |
| SMILES | NCCN.O=C1C=CC(=O)C(O)=C1 |
| InChI | InChI=1S/C6H4O3.C2H8N2/c7-4-1-2-5(8)6(9)3-4;3-1-2-4/h1-3,9H;1-4H2 |
| InChIKey | WDOYECNKMXFHAX-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione?
The IUPAC name of ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione (CID 67782254) is ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione.
What is the SMILES notation for ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione?
The canonical SMILES for ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione is NCCN.O=C1C=CC(=O)C(O)=C1.
What is the InChIKey of ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione?
The InChIKey is WDOYECNKMXFHAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O3.C2H8N2/c7-4-1-2-5(8)6(9)3-4;3-1-2-4/h1-3,9H;1-4H2.
What are the key properties of ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione?
ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione has a molecular weight of 184.20 g/mol, XLogP of -0.96, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione is sourced from PubChem (CID 67782254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).