C8H12N2O3 — CID 67782254
ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione (PubChem CID 67782254) has the molecular formula C8H12N2O3 and a molecular weight of 184.20 g/mol. Its IUPAC name is ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 67782254 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | ethane-1,2-diamine;2-hydroxycyclohexa-2,5-diene-1,4-dione |
| SMILES | NCCN.O=C1C=CC(=O)C(O)=C1 |
| InChI | InChI=1S/C6H4O3.C2H8N2/c7-4-1-2-5(8)6(9)3-4;3-1-2-4/h1-3,9H;1-4H2 |
| InChIKey | WDOYECNKMXFHAX-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|