C10H15NO2 — CID 15692400
2-hydroxycyclohepta-2,4,6-trien-1-one;propan-1-amine (PubChem CID 15692400) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-hydroxycyclohepta-2,4,6-trien-1-one;propan-1-amine.
| Compound Name | 2-hydroxycyclohepta-2,4,6-trien-1-one;propan-1-amine |
|---|---|
| PubChem CID | 15692400 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 2-hydroxycyclohepta-2,4,6-trien-1-one;propan-1-amine |
| SMILES | CCCN.O=c1cccccc1O |
| InChI | InChI=1S/C7H6O2.C3H9N/c8-6-4-2-1-3-5-7(6)9;1-2-3-4/h1-5H,(H,8,9);2-4H2,1H3 |
| InChIKey | LZOMFGTUDHNBOL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |