C27H27FO6 — CID 67782525
4-(4-fluorophenyl)-3-(hydroxymethyl)-7-[(E)-3-(4-methoxyoxan-4-yl)prop-2-enoxy]naphthalene-2-carboxylic acid (PubChem CID 67782525) has the molecular formula C27H27FO6 and a molecular weight of 466.51 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3-(hydroxymethyl)-7-[(E)-3-(4-methoxyoxan-4-yl)prop-2-enoxy]naphthalene-2-carboxylic acid.
| Compound Name | 4-(4-fluorophenyl)-3-(hydroxymethyl)-7-[(E)-3-(4-methoxyoxan-4-yl)prop-2-enoxy]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 67782525 |
| Molecular Formula | C27H27FO6 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 4-(4-fluorophenyl)-3-(hydroxymethyl)-7-[(E)-3-(4-methoxyoxan-4-yl)prop-2-enoxy]naphthalene-2-carboxylic acid |
| SMILES | COC1(/C=C/COc2ccc3c(-c4ccc(F)cc4)c(CO)c(C(=O)O)cc3c2)CCOCC1 |
| InChI | InChI=1S/C27H27FO6/c1-32-27(10-13-33-14-11-27)9-2-12-34-21-7-8-22-19(15-21)16-23(26(30)31)24(17-29)25(22)18-3-5-20(28)6-4-18/h2-9,15-16,29H,10-14,17H2,1H3,(H,30,31)/b9-2+ |
| InChIKey | WILXOLLBDGETGP-XNWCZRBMSA-N |
| XLogP | 4.97 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|