C21H22N2O11S2 — CID 67784192
(5R,8S)-8-[(3,4-dihydroxyphenyl)sulfonylamino]-14,16-dihydroxy-13-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-5-carboxylic acid (PubChem CID 67784192) has the molecular formula C21H22N2O11S2 and a molecular weight of 542.54 g/mol. Its IUPAC name is (5R,8S)-8-[(3,4-dihydroxyphenyl)sulfonylamino]-14,16-dihydroxy-13-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-5-carboxylic acid.
| Compound Name | (5R,8S)-8-[(3,4-dihydroxyphenyl)sulfonylamino]-14,16-dihydroxy-13-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 67784192 |
| Molecular Formula | C21H22N2O11S2 |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | (5R,8S)-8-[(3,4-dihydroxyphenyl)sulfonylamino]-14,16-dihydroxy-13-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-5-carboxylic acid |
| SMILES | Cc1c(O)cc(O)c2c1C(=O)OC[C@H](NS(=O)(=O)c1ccc(O)c(O)c1)C(=O)N[C@H](C(=O)O)CSC2 |
| InChI | InChI=1S/C21H22N2O11S2/c1-9-15(25)5-16(26)11-7-35-8-13(20(29)30)22-19(28)12(6-34-21(31)18(9)11)23-36(32,33)10-2-3-14(24)17(27)4-10/h2-5,12-13,23-27H,6-8H2,1H3,(H,22,28)(H,29,30)/t12-,13-/m0/s1 |
| InChIKey | CZMOGTQIJXDUBK-STQMWFEESA-N |
| XLogP | 0.14 |
| TPSA | 219.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|