C22H30ClN7O4 — CID 67791860
2-[[2-[3-[4-(5-chloro-2-methoxyphenyl)piperazin-1-yl]propylamino]pyrimidine-4-carbonyl]amino]ethyl carbamate (PubChem CID 67791860) has the molecular formula C22H30ClN7O4 and a molecular weight of 491.98 g/mol. Its IUPAC name is 2-[[2-[3-[4-(5-chloro-2-methoxyphenyl)piperazin-1-yl]propylamino]pyrimidine-4-carbonyl]amino]ethyl carbamate.
| Compound Name | 2-[[2-[3-[4-(5-chloro-2-methoxyphenyl)piperazin-1-yl]propylamino]pyrimidine-4-carbonyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 67791860 |
| Molecular Formula | C22H30ClN7O4 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 2-[[2-[3-[4-(5-chloro-2-methoxyphenyl)piperazin-1-yl]propylamino]pyrimidine-4-carbonyl]amino]ethyl carbamate |
| SMILES | COc1ccc(Cl)cc1N1CCN(CCCNc2nccc(C(=O)NCCOC(N)=O)n2)CC1 |
| InChI | InChI=1S/C22H30ClN7O4/c1-33-19-4-3-16(23)15-18(19)30-12-10-29(11-13-30)9-2-6-26-22-27-7-5-17(28-22)20(31)25-8-14-34-21(24)32/h3-5,7,15H,2,6,8-14H2,1H3,(H2,24,32)(H,25,31)(H,26,27,28) |
| InChIKey | QYOUBZFYALYCSF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|