C23H32ClN5O3 — CID 11145007
5-acetyl-4-[4-[4-(5-chloro-2-methoxyphenyl)piperazin-1-yl]butylamino]-2,6-dimethylpyridazin-3-one (PubChem CID 11145007) has the molecular formula C23H32ClN5O3 and a molecular weight of 461.99 g/mol. Its IUPAC name is 5-acetyl-4-[4-[4-(5-chloro-2-methoxyphenyl)piperazin-1-yl]butylamino]-2,6-dimethylpyridazin-3-one.
| Compound Name | 5-acetyl-4-[4-[4-(5-chloro-2-methoxyphenyl)piperazin-1-yl]butylamino]-2,6-dimethylpyridazin-3-one |
|---|---|
| PubChem CID | 11145007 |
| Molecular Formula | C23H32ClN5O3 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 5-acetyl-4-[4-[4-(5-chloro-2-methoxyphenyl)piperazin-1-yl]butylamino]-2,6-dimethylpyridazin-3-one |
| SMILES | COc1ccc(Cl)cc1N1CCN(CCCCNc2c(C(C)=O)c(C)nn(C)c2=O)CC1 |
| InChI | InChI=1S/C23H32ClN5O3/c1-16-21(17(2)30)22(23(31)27(3)26-16)25-9-5-6-10-28-11-13-29(14-12-28)19-15-18(24)7-8-20(19)32-4/h7-8,15,25H,5-6,9-14H2,1-4H3 |
| InChIKey | LQABNCQTZIOQJK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|