C26H42O7 — CID 67794127
(3R,5R)-7-[(2S,6S,8S,8aR)-8-[(2S)-2-ethyl-2-methylpentanoyl]oxy-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 67794127) has the molecular formula C26H42O7 and a molecular weight of 466.62 g/mol. Its IUPAC name is (3R,5R)-7-[(2S,6S,8S,8aR)-8-[(2S)-2-ethyl-2-methylpentanoyl]oxy-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | (3R,5R)-7-[(2S,6S,8S,8aR)-8-[(2S)-2-ethyl-2-methylpentanoyl]oxy-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 67794127 |
| Molecular Formula | C26H42O7 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | (3R,5R)-7-[(2S,6S,8S,8aR)-8-[(2S)-2-ethyl-2-methylpentanoyl]oxy-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | CCC[C@](C)(CC)C(=O)O[C@H]1C[C@H](O)C=C2C=C[C@H](C)C(CC[C@@H](O)C[C@@H](O)CC(=O)O)[C@H]21 |
| InChI | InChI=1S/C26H42O7/c1-5-11-26(4,6-2)25(32)33-22-14-19(28)12-17-8-7-16(3)21(24(17)22)10-9-18(27)13-20(29)15-23(30)31/h7-8,12,16,18-22,24,27-29H,5-6,9-11,13-15H2,1-4H3,(H,30,31)/t16-,18+,19+,20+,21?,22-,24-,26-/m0/s1 |
| InChIKey | UZIAOPLCXZGJNR-PMTIBJHJSA-N |
| XLogP | 3.61 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |