C23H31NO9 — CID 67794406
1-(3-methoxy-5-nitro-4-propoxyphenyl)-1-(3,4,5-trimethoxyphenyl)butane-1,4-diol (PubChem CID 67794406) has the molecular formula C23H31NO9 and a molecular weight of 465.50 g/mol. Its IUPAC name is 1-(3-methoxy-5-nitro-4-propoxyphenyl)-1-(3,4,5-trimethoxyphenyl)butane-1,4-diol.
| Compound Name | 1-(3-methoxy-5-nitro-4-propoxyphenyl)-1-(3,4,5-trimethoxyphenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 67794406 |
| Molecular Formula | C23H31NO9 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 1-(3-methoxy-5-nitro-4-propoxyphenyl)-1-(3,4,5-trimethoxyphenyl)butane-1,4-diol |
| SMILES | CCCOc1c(OC)cc(C(O)(CCCO)c2cc(OC)c(OC)c(OC)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H31NO9/c1-6-10-33-21-17(24(27)28)11-15(12-18(21)29-2)23(26,8-7-9-25)16-13-19(30-3)22(32-5)20(14-16)31-4/h11-14,25-26H,6-10H2,1-5H3 |
| InChIKey | AKKNLDNGLCRSGF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|