C27H31N3O4 — CID 67795992
benzyl (Z)-2-cyano-3-(2-hexoxy-8-propan-2-yloxyimidazo[1,2-a]pyridin-3-yl)prop-2-enoate (PubChem CID 67795992) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is benzyl (Z)-2-cyano-3-(2-hexoxy-8-propan-2-yloxyimidazo[1,2-a]pyridin-3-yl)prop-2-enoate.
| Compound Name | benzyl (Z)-2-cyano-3-(2-hexoxy-8-propan-2-yloxyimidazo[1,2-a]pyridin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 67795992 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | benzyl (Z)-2-cyano-3-(2-hexoxy-8-propan-2-yloxyimidazo[1,2-a]pyridin-3-yl)prop-2-enoate |
| SMILES | CCCCCCOc1nc2c(OC(C)C)cccn2c1/C=C(/C#N)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H31N3O4/c1-4-5-6-10-16-32-26-23(30-15-11-14-24(25(30)29-26)34-20(2)3)17-22(18-28)27(31)33-19-21-12-8-7-9-13-21/h7-9,11-15,17,20H,4-6,10,16,19H2,1-3H3/b22-17- |
| InChIKey | HYTVDPPVLSIICN-XLNRJJMWSA-N |
| XLogP | 5.73 |
| TPSA | 85.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|