C22H25N3O4 — CID 139928770
2-cyano-3-(8-cyclohexyloxy-2-cyclopentyloxyimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid (PubChem CID 139928770) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-cyano-3-(8-cyclohexyloxy-2-cyclopentyloxyimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid.
| Compound Name | 2-cyano-3-(8-cyclohexyloxy-2-cyclopentyloxyimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 139928770 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-cyano-3-(8-cyclohexyloxy-2-cyclopentyloxyimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid |
| SMILES | N#CC(=Cc1c(OC2CCCC2)nc2c(OC3CCCCC3)cccn12)C(=O)O |
| InChI | InChI=1S/C22H25N3O4/c23-14-15(22(26)27)13-18-21(29-17-9-4-5-10-17)24-20-19(11-6-12-25(18)20)28-16-7-2-1-3-8-16/h6,11-13,16-17H,1-5,7-10H2,(H,26,27) |
| InChIKey | YBUAZCLGQWSRCR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|