C25H33N3O6 — CID 139928782
6-[3-(2-carboxy-2-cyanoethenyl)-2-octoxyimidazo[1,2-a]pyridin-8-yl]oxyhexanoic acid (PubChem CID 139928782) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is 6-[3-(2-carboxy-2-cyanoethenyl)-2-octoxyimidazo[1,2-a]pyridin-8-yl]oxyhexanoic acid.
| Compound Name | 6-[3-(2-carboxy-2-cyanoethenyl)-2-octoxyimidazo[1,2-a]pyridin-8-yl]oxyhexanoic acid |
|---|---|
| PubChem CID | 139928782 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 6-[3-(2-carboxy-2-cyanoethenyl)-2-octoxyimidazo[1,2-a]pyridin-8-yl]oxyhexanoic acid |
| SMILES | CCCCCCCCOc1nc2c(OCCCCCC(=O)O)cccn2c1C=C(C#N)C(=O)O |
| InChI | InChI=1S/C25H33N3O6/c1-2-3-4-5-6-9-16-34-24-20(17-19(18-26)25(31)32)28-14-11-12-21(23(28)27-24)33-15-10-7-8-13-22(29)30/h11-12,14,17H,2-10,13,15-16H2,1H3,(H,29,30)(H,31,32) |
| InChIKey | VRJBIHBECOKXSC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 134.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|