C28H28N4O6 — CID 67800771
but-2-enedioic acid;4-[2-[3-(3-phenylpyrazolo[5,4-b]pyridin-1-yl)phenoxy]ethyl]morpholine (PubChem CID 67800771) has the molecular formula C28H28N4O6 and a molecular weight of 516.55 g/mol. Its IUPAC name is but-2-enedioic acid;4-[2-[3-(3-phenylpyrazolo[5,4-b]pyridin-1-yl)phenoxy]ethyl]morpholine.
| Compound Name | but-2-enedioic acid;4-[2-[3-(3-phenylpyrazolo[5,4-b]pyridin-1-yl)phenoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 67800771 |
| Molecular Formula | C28H28N4O6 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | but-2-enedioic acid;4-[2-[3-(3-phenylpyrazolo[5,4-b]pyridin-1-yl)phenoxy]ethyl]morpholine |
| SMILES | O=C(O)C=CC(=O)O.c1ccc(-c2nn(-c3cccc(OCCN4CCOCC4)c3)c3ncccc23)cc1 |
| InChI | InChI=1S/C24H24N4O2.C4H4O4/c1-2-6-19(7-3-1)23-22-10-5-11-25-24(22)28(26-23)20-8-4-9-21(18-20)30-17-14-27-12-15-29-16-13-27;5-3(6)1-2-4(7)8/h1-11,18H,12-17H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | CXHAFESBEKOMFP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|