C28H29N5O6 — CID 67802601
but-2-enedioic acid;N-[2-(dimethylamino)ethyl]-2-[4-(1-phenylpyrazolo[5,4-b]pyridin-3-yl)phenoxy]acetamide (PubChem CID 67802601) has the molecular formula C28H29N5O6 and a molecular weight of 531.57 g/mol. Its IUPAC name is but-2-enedioic acid;N-[2-(dimethylamino)ethyl]-2-[4-(1-phenylpyrazolo[5,4-b]pyridin-3-yl)phenoxy]acetamide.
| Compound Name | but-2-enedioic acid;N-[2-(dimethylamino)ethyl]-2-[4-(1-phenylpyrazolo[5,4-b]pyridin-3-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 67802601 |
| Molecular Formula | C28H29N5O6 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | but-2-enedioic acid;N-[2-(dimethylamino)ethyl]-2-[4-(1-phenylpyrazolo[5,4-b]pyridin-3-yl)phenoxy]acetamide |
| SMILES | CN(C)CCNC(=O)COc1ccc(-c2nn(-c3ccccc3)c3ncccc23)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C24H25N5O2.C4H4O4/c1-28(2)16-15-25-22(30)17-31-20-12-10-18(11-13-20)23-21-9-6-14-26-24(21)29(27-23)19-7-4-3-5-8-19;5-3(6)1-2-4(7)8/h3-14H,15-17H2,1-2H3,(H,25,30);1-2H,(H,5,6)(H,7,8) |
| InChIKey | ZYRRXELLJHVUKE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|