C28H29ClN4O5 — CID 67801004
but-2-enedioic acid;3-[4-[1-[(4-chlorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 67801004) has the molecular formula C28H29ClN4O5 and a molecular weight of 537.02 g/mol. Its IUPAC name is but-2-enedioic acid;3-[4-[1-[(4-chlorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | but-2-enedioic acid;3-[4-[1-[(4-chlorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 67801004 |
| Molecular Formula | C28H29ClN4O5 |
| Molecular Weight | 537.02 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | but-2-enedioic acid;3-[4-[1-[(4-chlorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1ccc(-c2nn(Cc3ccc(Cl)cc3)c3ncccc23)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C24H25ClN4O.C4H4O4/c1-28(2)15-4-16-30-21-12-8-19(9-13-21)23-22-5-3-14-26-24(22)29(27-23)17-18-6-10-20(25)11-7-18;5-3(6)1-2-4(7)8/h3,5-14H,4,15-17H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | ACUCBKLLTKVYOC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.02 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|