C15H10ClNO5S — CID 67803505
[3-(benzenesulfonyl)-5-chloro-1H-indol-2-yl] hydrogen carbonate (PubChem CID 67803505) has the molecular formula C15H10ClNO5S and a molecular weight of 351.77 g/mol. Its IUPAC name is [3-(benzenesulfonyl)-5-chloro-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [3-(benzenesulfonyl)-5-chloro-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67803505 |
| Molecular Formula | C15H10ClNO5S |
| Molecular Weight | 351.77 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | [3-(benzenesulfonyl)-5-chloro-1H-indol-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1[nH]c2ccc(Cl)cc2c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H10ClNO5S/c16-9-6-7-12-11(8-9)13(14(17-12)22-15(18)19)23(20,21)10-4-2-1-3-5-10/h1-8,17H,(H,18,19) |
| InChIKey | OHEMSBLIPJIVLJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.77 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |