C25H19F3N4O7 — CID 67804070
(1R,12S)-7-oxo-4-(trifluoromethyl)-10-(5,6,7-trimethoxycinnoline-3-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3-carboxylic acid (PubChem CID 67804070) has the molecular formula C25H19F3N4O7 and a molecular weight of 544.44 g/mol. Its IUPAC name is (1R,12S)-7-oxo-4-(trifluoromethyl)-10-(5,6,7-trimethoxycinnoline-3-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3-carboxylic acid.
| Compound Name | (1R,12S)-7-oxo-4-(trifluoromethyl)-10-(5,6,7-trimethoxycinnoline-3-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3-carboxylic acid |
|---|---|
| PubChem CID | 67804070 |
| Molecular Formula | C25H19F3N4O7 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | (1R,12S)-7-oxo-4-(trifluoromethyl)-10-(5,6,7-trimethoxycinnoline-3-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3-carboxylic acid |
| SMILES | COc1cc2nnc(C(=O)N3C[C@H]4C[C@@]45C3=CC(=O)c3[nH]c(C(F)(F)F)c(C(=O)O)c35)cc2c(OC)c1OC |
| InChI | InChI=1S/C25H19F3N4O7/c1-37-14-5-11-10(19(38-2)20(14)39-3)4-12(31-30-11)22(34)32-8-9-7-24(9)15(32)6-13(33)18-17(24)16(23(35)36)21(29-18)25(26,27)28/h4-6,9,29H,7-8H2,1-3H3,(H,35,36)/t9-,24+/m1/s1 |
| InChIKey | ZUTKQLLQKROSAJ-ITSYKEIMSA-N |
| XLogP | 3.19 |
| TPSA | 143.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |