C19H26O2 — CID 67807049
(1S,3S,6S,7S,9S)-1,7-dimethyl-9-[(2-methylphenyl)methoxy]-2-oxatricyclo[4.3.1.03,7]decane (PubChem CID 67807049) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is (1S,3S,6S,7S,9S)-1,7-dimethyl-9-[(2-methylphenyl)methoxy]-2-oxatricyclo[4.3.1.03,7]decane.
| Compound Name | (1S,3S,6S,7S,9S)-1,7-dimethyl-9-[(2-methylphenyl)methoxy]-2-oxatricyclo[4.3.1.03,7]decane |
|---|---|
| PubChem CID | 67807049 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (1S,3S,6S,7S,9S)-1,7-dimethyl-9-[(2-methylphenyl)methoxy]-2-oxatricyclo[4.3.1.03,7]decane |
| SMILES | Cc1ccccc1CO[C@H]1C[C@@]2(C)[C@H]3CC[C@@H]2O[C@@]1(C)C3 |
| InChI | InChI=1S/C19H26O2/c1-13-6-4-5-7-14(13)12-20-17-11-18(2)15-8-9-16(18)21-19(17,3)10-15/h4-7,15-17H,8-12H2,1-3H3/t15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | LKQWHMBPBVWJNX-VMXHOPILSA-N |
| XLogP | 4.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |