C20H30NO6P — CID 70475914
N-diethoxyphosphoryl-4-methyl-3-[(2-methylphenyl)methoxy]-7-oxabicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 70475914) has the molecular formula C20H30NO6P and a molecular weight of 411.44 g/mol. Its IUPAC name is N-diethoxyphosphoryl-4-methyl-3-[(2-methylphenyl)methoxy]-7-oxabicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | N-diethoxyphosphoryl-4-methyl-3-[(2-methylphenyl)methoxy]-7-oxabicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 70475914 |
| Molecular Formula | C20H30NO6P |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-diethoxyphosphoryl-4-methyl-3-[(2-methylphenyl)methoxy]-7-oxabicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CCOP(=O)(NC(=O)C12CCC(C)(O1)C(OCc1ccccc1C)C2)OCC |
| InChI | InChI=1S/C20H30NO6P/c1-5-25-28(23,26-6-2)21-18(22)20-12-11-19(4,27-20)17(13-20)24-14-16-10-8-7-9-15(16)3/h7-10,17H,5-6,11-14H2,1-4H3,(H,21,22,23) |
| InChIKey | PPGHAPCIPSGKND-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|