C26H22N4O3 — CID 67807071
9-(4-aminophenoxy)tricyclo[6.3.1.02,7]dodeca-1(12),2,4,6,8,10-hexaen-12-amine;benzene-1,4-dicarboxamide (PubChem CID 67807071) has the molecular formula C26H22N4O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is 9-(4-aminophenoxy)tricyclo[6.3.1.02,7]dodeca-1(12),2,4,6,8,10-hexaen-12-amine;benzene-1,4-dicarboxamide.
| Compound Name | 9-(4-aminophenoxy)tricyclo[6.3.1.02,7]dodeca-1(12),2,4,6,8,10-hexaen-12-amine;benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 67807071 |
| Molecular Formula | C26H22N4O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 9-(4-aminophenoxy)tricyclo[6.3.1.02,7]dodeca-1(12),2,4,6,8,10-hexaen-12-amine;benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)cc1.Nc1ccc(Oc2ccc3c(N)c2-c2ccccc2-3)cc1 |
| InChI | InChI=1S/C18H14N2O.C8H8N2O2/c19-11-5-7-12(8-6-11)21-16-10-9-15-13-3-1-2-4-14(13)17(16)18(15)20;9-7(11)5-1-2-6(4-3-5)8(10)12/h1-10H,19-20H2;1-4H,(H2,9,11)(H2,10,12) |
| InChIKey | MAAGOYXHUKZXAF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 147.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|