C20H25NO4 — CID 67807585
[(1R,2R,3S,5S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] benzoate (PubChem CID 67807585) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is [(1R,2R,3S,5S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] benzoate.
| Compound Name | [(1R,2R,3S,5S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] benzoate |
|---|---|
| PubChem CID | 67807585 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | [(1R,2R,3S,5S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] benzoate |
| SMILES | CCOC(=O)/C=C/[C@H]1[C@@H](OC(=O)c2ccccc2)C[C@@H]2CC[C@H]1N2C |
| InChI | InChI=1S/C20H25NO4/c1-3-24-19(22)12-10-16-17-11-9-15(21(17)2)13-18(16)25-20(23)14-7-5-4-6-8-14/h4-8,10,12,15-18H,3,9,11,13H2,1-2H3/b12-10+/t15-,16+,17+,18-/m0/s1 |
| InChIKey | UCICPDUSVHGJAC-ZXMQZYSGSA-N |
| XLogP | 2.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|