C24H23N3O7S — CID 67808595
tert-butyl 3-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazole-4-carbonyl)indole-1-carboxylate;oxalic acid (PubChem CID 67808595) has the molecular formula C24H23N3O7S and a molecular weight of 497.53 g/mol. Its IUPAC name is tert-butyl 3-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazole-4-carbonyl)indole-1-carboxylate;oxalic acid.
| Compound Name | tert-butyl 3-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazole-4-carbonyl)indole-1-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 67808595 |
| Molecular Formula | C24H23N3O7S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | tert-butyl 3-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazole-4-carbonyl)indole-1-carboxylate;oxalic acid |
| SMILES | CC(C)(C)OC(=O)n1cc(C(=O)C2=CSC(c3cccnc3)N2)c2ccccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H21N3O3S.C2H2O4/c1-22(2,3)28-21(27)25-12-16(15-8-4-5-9-18(15)25)19(26)17-13-29-20(24-17)14-7-6-10-23-11-14;3-1(4)2(5)6/h4-13,20,24H,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | QFNXGDDFLJDPAE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|