C29H26N4O7S — CID 67809642
N,N-dimethyl-6-phenylmethoxy-3-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazole-4-carbonyl)indole-1-carboxamide;oxalic acid (PubChem CID 67809642) has the molecular formula C29H26N4O7S and a molecular weight of 574.62 g/mol. Its IUPAC name is N,N-dimethyl-6-phenylmethoxy-3-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazole-4-carbonyl)indole-1-carboxamide;oxalic acid.
| Compound Name | N,N-dimethyl-6-phenylmethoxy-3-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazole-4-carbonyl)indole-1-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 67809642 |
| Molecular Formula | C29H26N4O7S |
| Molecular Weight | 574.62 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | N,N-dimethyl-6-phenylmethoxy-3-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazole-4-carbonyl)indole-1-carboxamide;oxalic acid |
| SMILES | CN(C)C(=O)n1cc(C(=O)C2=CSC(c3cccnc3)N2)c2ccc(OCc3ccccc3)cc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H24N4O3S.C2H2O4/c1-30(2)27(33)31-15-22(25(32)23-17-35-26(29-23)19-9-6-12-28-14-19)21-11-10-20(13-24(21)31)34-16-18-7-4-3-5-8-18;3-1(4)2(5)6/h3-15,17,26,29H,16H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | IJHWFVOUZSCJFN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|