About (1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone
(1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone (PubChem CID 67808953) has the molecular formula C19H17N3O3S2
and a molecular weight of 399.50 g/mol. Its IUPAC name is (1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | (1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone |
| PubChem CID | 67808953 |
| Molecular Formula | C19H17N3O3S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | (1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone |
| SMILES | CCS(=O)(=O)n1cc(C(=O)C2=CSC(c3cccnc3)N2)c2ccccc21 |
| InChI | InChI=1S/C19H17N3O3S2/c1-2-27(24,25)22-11-15(14-7-3-4-8-17(14)22)18(23)16-12-26-19(21-16)13-6-5-9-20-10-13/h3-12,19,21H,2H2,1H3 |
| InChIKey | LBYQCZIDOQILIN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone?
The IUPAC name of (1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone (CID 67808953) is (1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone.
What is the SMILES notation for (1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone?
The canonical SMILES for (1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone is CCS(=O)(=O)n1cc(C(=O)C2=CSC(c3cccnc3)N2)c2ccccc21.
What is the InChIKey of (1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone?
The InChIKey is LBYQCZIDOQILIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O3S2/c1-2-27(24,25)22-11-15(14-7-3-4-8-17(14)22)18(23)16-12-26-19(21-16)13-6-5-9-20-10-13/h3-12,19,21H,2H2,1H3.
What are the key properties of (1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone?
(1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone has a molecular weight of 399.50 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylsulfonylindol-3-yl)-(2-pyridin-3-yl-2,3-dihydro-1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 67808953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).