C50H40N6O8S2 — CID 57040905
bis[5-phenylmethoxy-1-(2-pyridin-3-yl-1,3-thiazolidine-4-carbonyl)indol-3-yl] oxalate (PubChem CID 57040905) has the molecular formula C50H40N6O8S2 and a molecular weight of 917.04 g/mol. Its IUPAC name is bis[5-phenylmethoxy-1-(2-pyridin-3-yl-1,3-thiazolidine-4-carbonyl)indol-3-yl] oxalate.
| Compound Name | bis[5-phenylmethoxy-1-(2-pyridin-3-yl-1,3-thiazolidine-4-carbonyl)indol-3-yl] oxalate |
|---|---|
| PubChem CID | 57040905 |
| Molecular Formula | C50H40N6O8S2 |
| Molecular Weight | 917.04 g/mol |
| Exact Mass | 916.23 |
| IUPAC Name | bis[5-phenylmethoxy-1-(2-pyridin-3-yl-1,3-thiazolidine-4-carbonyl)indol-3-yl] oxalate |
| SMILES | O=C(Oc1cn(C(=O)C2CSC(c3cccnc3)N2)c2ccc(OCc3ccccc3)cc12)C(=O)Oc1cn(C(=O)C2CSC(c3cccnc3)N2)c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C50H40N6O8S2/c57-47(39-29-65-45(53-39)33-13-7-19-51-23-33)55-25-43(37-21-35(15-17-41(37)55)61-27-31-9-3-1-4-10-31)63-49(59)50(60)64-44-26-56(48(58)40-30-66-46(54-40)34-14-8-20-52-24-34)42-18-16-36(22-38(42)44)62-28-32-11-5-2-6-12-32/h1-26,39-40,45-46,53-54H,27-30H2 |
| InChIKey | DJEMWKVKACYKOZ-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 164.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.04 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|